About 2-silyloxane-2-sulfinate
2-silyloxane-2-sulfinate (PubChem CID 123267264) has the molecular formula C5H11O3SSi-
and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-silyloxane-2-sulfinate.
Molecular Properties
| Compound Name | 2-silyloxane-2-sulfinate |
| PubChem CID | 123267264 |
| Molecular Formula | C5H11O3SSi- |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 2-silyloxane-2-sulfinate |
| SMILES | O=S([O-])C1([SiH3])CCCCO1 |
| InChI | InChI=1S/C5H12O3SSi/c6-9(7)5(10)3-1-2-4-8-5/h1-4H2,10H3,(H,6,7)/p-1 |
| InChIKey | YAVKVDJJUXXGCB-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-silyloxane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-silyloxane-2-sulfinate?
The IUPAC name of 2-silyloxane-2-sulfinate (CID 123267264) is 2-silyloxane-2-sulfinate.
What is the SMILES notation for 2-silyloxane-2-sulfinate?
The canonical SMILES for 2-silyloxane-2-sulfinate is O=S([O-])C1([SiH3])CCCCO1.
What is the InChIKey of 2-silyloxane-2-sulfinate?
The InChIKey is YAVKVDJJUXXGCB-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12O3SSi/c6-9(7)5(10)3-1-2-4-8-5/h1-4H2,10H3,(H,6,7)/p-1.
What are the key properties of 2-silyloxane-2-sulfinate?
2-silyloxane-2-sulfinate has a molecular weight of 179.29 g/mol, XLogP of -0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-silyloxane-2-sulfinate is sourced from PubChem (CID 123267264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).