About 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione
7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (PubChem CID 123267416) has the molecular formula C9H9FN4O2
and a molecular weight of 224.19 g/mol. Its IUPAC name is 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
Molecular Properties
| Compound Name | 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| PubChem CID | 123267416 |
| Molecular Formula | C9H9FN4O2 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| SMILES | CN(C)c1cn2cc(F)c(=O)nc2[nH]c1=O |
| InChI | InChI=1S/C9H9FN4O2/c1-13(2)6-4-14-3-5(10)7(15)11-9(14)12-8(6)16/h3-4H,1-2H3,(H,11,12,15,16) |
| InChIKey | VNXVPVNLVGHCQN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The IUPAC name of 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (CID 123267416) is 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
What is the SMILES notation for 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The canonical SMILES for 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is CN(C)c1cn2cc(F)c(=O)nc2[nH]c1=O.
What is the InChIKey of 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
The InChIKey is VNXVPVNLVGHCQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4O2/c1-13(2)6-4-14-3-5(10)7(15)11-9(14)12-8(6)16/h3-4H,1-2H3,(H,11,12,15,16).
What are the key properties of 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione?
7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione has a molecular weight of 224.19 g/mol, XLogP of -0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)-3-fluoro-9H-pyrimido[1,2-a]pyrimidine-2,8-dione is sourced from PubChem (CID 123267416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).