C30H33NO — CID 123267820
3-(1-benzofuran-2-yl)-1-[(3,4-dimethylcyclohepta-1,4,6-trien-1-yl)-(5,6-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]azetidine (PubChem CID 123267820) has the molecular formula C30H33NO and a molecular weight of 423.60 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-1-[(3,4-dimethylcyclohepta-1,4,6-trien-1-yl)-(5,6-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]azetidine.
| Compound Name | 3-(1-benzofuran-2-yl)-1-[(3,4-dimethylcyclohepta-1,4,6-trien-1-yl)-(5,6-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]azetidine |
|---|---|
| PubChem CID | 123267820 |
| Molecular Formula | C30H33NO |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-1-[(3,4-dimethylcyclohepta-1,4,6-trien-1-yl)-(5,6-dimethylcyclohepta-1,3,6-trien-1-yl)methyl]azetidine |
| SMILES | CC1=CC=CC(C(C2=CC=CC(C)C(C)=C2)N2CC(c3cc4ccccc4o3)C2)=CC1C |
| InChI | InChI=1S/C30H33NO/c1-20-9-7-12-25(15-22(20)3)30(26-13-8-10-21(2)23(4)16-26)31-18-27(19-31)29-17-24-11-5-6-14-28(24)32-29/h5-17,20,23,27,30H,18-19H2,1-4H3 |
| InChIKey | XUBDNCKXAVAISO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |