C7H12F3NO3 — CID 123267888
N-(1,4-dihydroxypentan-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 123267888) has the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. Its IUPAC name is N-(1,4-dihydroxypentan-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1,4-dihydroxypentan-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 123267888 |
| Molecular Formula | C7H12F3NO3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-(1,4-dihydroxypentan-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | CC(O)CC(CO)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3/c1-4(13)2-5(3-12)11-6(14)7(8,9)10/h4-5,12-13H,2-3H2,1H3,(H,11,14) |
| InChIKey | XEGSOVHRBZQTPY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |