C10H17NO2S — CID 123268503
[5-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid (PubChem CID 123268503) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is [5-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid.
| Compound Name | [5-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid |
|---|---|
| PubChem CID | 123268503 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | [5-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid |
| SMILES | CNC1CC=CC(OC(=O)S)CCC1 |
| InChI | InChI=1S/C10H17NO2S/c1-11-8-4-2-6-9(7-3-5-8)13-10(12)14/h2,6,8-9,11H,3-5,7H2,1H3,(H,12,14) |
| InChIKey | FJQNIZHSEZBACK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|