C25H30N6O4S — CID 123268552
4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one (PubChem CID 123268552) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 123268552 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]but-2-en-1-one |
| SMILES | O=C(C=CCN1CCS(=O)(=O)CC1)N1CCc2c(cn3ncnc(NC(CO)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C25H30N6O4S/c32-17-22(19-5-2-1-3-6-19)28-25-24-21-8-10-30(15-20(21)16-31(24)27-18-26-25)23(33)7-4-9-29-11-13-36(34,35)14-12-29/h1-7,16,18,22,32H,8-15,17H2,(H,26,27,28) |
| InChIKey | UILQRFLFJKDRDR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|