C10H14BrNS — CID 123268638
4-bromo-2-hexa-1,3-dien-2-yl-5-methyl-4,5-dihydro-1,3-thiazole (PubChem CID 123268638) has the molecular formula C10H14BrNS and a molecular weight of 260.20 g/mol. Its IUPAC name is 4-bromo-2-hexa-1,3-dien-2-yl-5-methyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 4-bromo-2-hexa-1,3-dien-2-yl-5-methyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 123268638 |
| Molecular Formula | C10H14BrNS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-bromo-2-hexa-1,3-dien-2-yl-5-methyl-4,5-dihydro-1,3-thiazole |
| SMILES | C=C(C=CCC)C1=NC(Br)C(C)S1 |
| InChI | InChI=1S/C10H14BrNS/c1-4-5-6-7(2)10-12-9(11)8(3)13-10/h5-6,8-9H,2,4H2,1,3H3 |
| InChIKey | INRTUOUSOLSIQI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|