C24H25ClO6 — CID 123268814
6-[(2R,4R,5S)-4-(2-acetyloxyphenyl)-2-(2-chlorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 123268814) has the molecular formula C24H25ClO6 and a molecular weight of 444.91 g/mol. Its IUPAC name is 6-[(2R,4R,5S)-4-(2-acetyloxyphenyl)-2-(2-chlorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | 6-[(2R,4R,5S)-4-(2-acetyloxyphenyl)-2-(2-chlorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 123268814 |
| Molecular Formula | C24H25ClO6 |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 6-[(2R,4R,5S)-4-(2-acetyloxyphenyl)-2-(2-chlorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | CC(=O)Oc1ccccc1[C@@H]1O[C@H](c2ccccc2Cl)OC[C@@H]1CC=CCCC(=O)O |
| InChI | InChI=1S/C24H25ClO6/c1-16(26)30-21-13-8-6-11-19(21)23-17(9-3-2-4-14-22(27)28)15-29-24(31-23)18-10-5-7-12-20(18)25/h2-3,5-8,10-13,17,23-24H,4,9,14-15H2,1H3,(H,27,28)/t17-,23+,24+/m0/s1 |
| InChIKey | KHPNXZALGAHKMJ-PKKBDPGCSA-N |
| XLogP | 5.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|