C11H20N2O — CID 123268843
4-ethoxy-1-methyl-3,5,6,7,8,8a-hexahydro-2H-1,6-naphthyridine (PubChem CID 123268843) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-ethoxy-1-methyl-3,5,6,7,8,8a-hexahydro-2H-1,6-naphthyridine.
| Compound Name | 4-ethoxy-1-methyl-3,5,6,7,8,8a-hexahydro-2H-1,6-naphthyridine |
|---|---|
| PubChem CID | 123268843 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-ethoxy-1-methyl-3,5,6,7,8,8a-hexahydro-2H-1,6-naphthyridine |
| SMILES | CCOC1=C2CNCCC2N(C)CC1 |
| InChI | InChI=1S/C11H20N2O/c1-3-14-11-5-7-13(2)10-4-6-12-8-9(10)11/h10,12H,3-8H2,1-2H3 |
| InChIKey | CQVWJPBXHKQUSP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |