C12H18O2 — CID 123269114
(3Z)-1-methoxy-6,7-dimethylnona-3,5,8-trien-2-one (PubChem CID 123269114) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3Z)-1-methoxy-6,7-dimethylnona-3,5,8-trien-2-one.
| Compound Name | (3Z)-1-methoxy-6,7-dimethylnona-3,5,8-trien-2-one |
|---|---|
| PubChem CID | 123269114 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3Z)-1-methoxy-6,7-dimethylnona-3,5,8-trien-2-one |
| SMILES | C=CC(C)C(C)=C/C=C\C(=O)COC |
| InChI | InChI=1S/C12H18O2/c1-5-10(2)11(3)7-6-8-12(13)9-14-4/h5-8,10H,1,9H2,2-4H3/b8-6-,11-7? |
| InChIKey | XNOTUVVPYZKGMA-QMQVDZOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|