About 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine
1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine (PubChem CID 123269398) has the molecular formula C7H15N2+
and a molecular weight of 127.21 g/mol. Its IUPAC name is 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine.
Molecular Properties
| Compound Name | 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine |
| PubChem CID | 123269398 |
| Molecular Formula | C7H15N2+ |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine |
| SMILES | [H]/N=C(\CC)C1C[N+]1(C)C |
| InChI | InChI=1S/C7H15N2/c1-4-6(8)7-5-9(7,2)3/h7-8H,4-5H2,1-3H3/q+1/b8-6+ |
| InChIKey | KLTCAEOBQPCNIF-SOFGYWHQSA-N |
| XLogP | 0.87 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine?
The IUPAC name of 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine (CID 123269398) is 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine.
What is the SMILES notation for 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine?
The canonical SMILES for 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine is [H]/N=C(\CC)C1C[N+]1(C)C.
What is the InChIKey of 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine?
The InChIKey is KLTCAEOBQPCNIF-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H15N2/c1-4-6(8)7-5-9(7,2)3/h7-8H,4-5H2,1-3H3/q+1/b8-6+.
What are the key properties of 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine?
1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine has a molecular weight of 127.21 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dimethylaziridin-1-ium-2-yl)propan-1-imine is sourced from PubChem (CID 123269398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).