About 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid
5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid (PubChem CID 123269771) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid |
| PubChem CID | 123269771 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid |
| SMILES | CC1(C(=O)O)Cc2cc(O)c(O)cc2N1 |
| InChI | InChI=1S/C10H11NO4/c1-10(9(14)15)4-5-2-7(12)8(13)3-6(5)11-10/h2-3,11-13H,4H2,1H3,(H,14,15) |
| InChIKey | KFQAQMUJWQEZCQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid?
The IUPAC name of 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid (CID 123269771) is 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid.
What is the SMILES notation for 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid?
The canonical SMILES for 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid is CC1(C(=O)O)Cc2cc(O)c(O)cc2N1.
What is the InChIKey of 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid?
The InChIKey is KFQAQMUJWQEZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-10(9(14)15)4-5-2-7(12)8(13)3-6(5)11-10/h2-3,11-13H,4H2,1H3,(H,14,15).
What are the key properties of 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid?
5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid has a molecular weight of 209.20 g/mol, XLogP of 0.91, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxy-2-methyl-1,3-dihydroindole-2-carboxylic acid is sourced from PubChem (CID 123269771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).