About 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane
1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane (PubChem CID 123269822) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane.
Molecular Properties
| Compound Name | 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane |
| PubChem CID | 123269822 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane |
| SMILES | CC=C=CCC1C(C)C1CC |
| InChI | InChI=1S/C11H18/c1-4-6-7-8-11-9(3)10(11)5-2/h4,7,9-11H,5,8H2,1-3H3 |
| InChIKey | KLZADDGLFWVLRK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane?
The IUPAC name of 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane (CID 123269822) is 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane.
What is the SMILES notation for 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane?
The canonical SMILES for 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane is CC=C=CCC1C(C)C1CC.
What is the InChIKey of 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane?
The InChIKey is KLZADDGLFWVLRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-4-6-7-8-11-9(3)10(11)5-2/h4,7,9-11H,5,8H2,1-3H3.
What are the key properties of 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane?
1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane has a molecular weight of 150.26 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methyl-3-penta-2,3-dienylcyclopropane is sourced from PubChem (CID 123269822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).