About 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol
2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol (PubChem CID 123270485) has the molecular formula C8H13Cl3O
and a molecular weight of 231.55 g/mol. Its IUPAC name is 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol |
| PubChem CID | 123270485 |
| Molecular Formula | C8H13Cl3O |
| Molecular Weight | 231.55 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol |
| SMILES | CC1C(O)C(Cl)C(Cl)C(C)C1Cl |
| InChI | InChI=1S/C8H13Cl3O/c1-3-5(9)4(2)8(12)7(11)6(3)10/h3-8,12H,1-2H3 |
| InChIKey | FBMNWSHJPRDZDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol?
The IUPAC name of 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol (CID 123270485) is 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol.
What is the SMILES notation for 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol?
The canonical SMILES for 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol is CC1C(O)C(Cl)C(Cl)C(C)C1Cl.
What is the InChIKey of 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol?
The InChIKey is FBMNWSHJPRDZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl3O/c1-3-5(9)4(2)8(12)7(11)6(3)10/h3-8,12H,1-2H3.
What are the key properties of 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol?
2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol has a molecular weight of 231.55 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol is sourced from PubChem (CID 123270485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).