C8H13Cl3O — CID 123270485
2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol (PubChem CID 123270485) has the molecular formula C8H13Cl3O and a molecular weight of 231.55 g/mol. Its IUPAC name is 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol.
| Compound Name | 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123270485 |
| Molecular Formula | C8H13Cl3O |
| Molecular Weight | 231.55 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2,3,5-trichloro-4,6-dimethylcyclohexan-1-ol |
| SMILES | CC1C(O)C(Cl)C(Cl)C(C)C1Cl |
| InChI | InChI=1S/C8H13Cl3O/c1-3-5(9)4(2)8(12)7(11)6(3)10/h3-8,12H,1-2H3 |
| InChIKey | FBMNWSHJPRDZDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|