About N'-but-1-enyl-2,3-dimethylbutanimidamide
N'-but-1-enyl-2,3-dimethylbutanimidamide (PubChem CID 123270725) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-but-1-enyl-2,3-dimethylbutanimidamide.
Molecular Properties
| Compound Name | N'-but-1-enyl-2,3-dimethylbutanimidamide |
| PubChem CID | 123270725 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-but-1-enyl-2,3-dimethylbutanimidamide |
| SMILES | CCC=C/N=C(\N)C(C)C(C)C |
| InChI | InChI=1S/C10H20N2/c1-5-6-7-12-10(11)9(4)8(2)3/h6-9H,5H2,1-4H3,(H2,11,12) |
| InChIKey | HVBZMCKSZMYRGU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-but-1-enyl-2,3-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-but-1-enyl-2,3-dimethylbutanimidamide?
The IUPAC name of N'-but-1-enyl-2,3-dimethylbutanimidamide (CID 123270725) is N'-but-1-enyl-2,3-dimethylbutanimidamide.
What is the SMILES notation for N'-but-1-enyl-2,3-dimethylbutanimidamide?
The canonical SMILES for N'-but-1-enyl-2,3-dimethylbutanimidamide is CCC=C/N=C(\N)C(C)C(C)C.
What is the InChIKey of N'-but-1-enyl-2,3-dimethylbutanimidamide?
The InChIKey is HVBZMCKSZMYRGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-5-6-7-12-10(11)9(4)8(2)3/h6-9H,5H2,1-4H3,(H2,11,12).
What are the key properties of N'-but-1-enyl-2,3-dimethylbutanimidamide?
N'-but-1-enyl-2,3-dimethylbutanimidamide has a molecular weight of 168.28 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-but-1-enyl-2,3-dimethylbutanimidamide is sourced from PubChem (CID 123270725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).