C14H28N3O+ — CID 123270864
4-[4-(tert-butylamino)-2,2-dimethyl-1H-1,3-diazet-3-ium-3-yl]cyclohexan-1-ol (PubChem CID 123270864) has the molecular formula C14H28N3O+ and a molecular weight of 254.40 g/mol. Its IUPAC name is 4-[4-(tert-butylamino)-2,2-dimethyl-1H-1,3-diazet-3-ium-3-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-(tert-butylamino)-2,2-dimethyl-1H-1,3-diazet-3-ium-3-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123270864 |
| Molecular Formula | C14H28N3O+ |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 4-[4-(tert-butylamino)-2,2-dimethyl-1H-1,3-diazet-3-ium-3-yl]cyclohexan-1-ol |
| SMILES | CC(C)(C)NC1=[N+](C2CCC(O)CC2)C(C)(C)N1 |
| InChI | InChI=1S/C14H27N3O/c1-13(2,3)15-12-16-14(4,5)17(12)10-6-8-11(18)9-7-10/h10-11,18H,6-9H2,1-5H3,(H,15,16)/p+1 |
| InChIKey | YFDSCXUOABDGFC-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 47.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|