C13H13FN2O4S — CID 123272232
8-fluoro-5,5-dihydroxy-1,5-dimethylthiochromeno[3,4-d]pyrazole-3-carboxylic acid (PubChem CID 123272232) has the molecular formula C13H13FN2O4S and a molecular weight of 312.32 g/mol. Its IUPAC name is 8-fluoro-5,5-dihydroxy-1,5-dimethylthiochromeno[3,4-d]pyrazole-3-carboxylic acid.
| Compound Name | 8-fluoro-5,5-dihydroxy-1,5-dimethylthiochromeno[3,4-d]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 123272232 |
| Molecular Formula | C13H13FN2O4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 8-fluoro-5,5-dihydroxy-1,5-dimethylthiochromeno[3,4-d]pyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)c2c1-c1cc(F)ccc1S(C)(O)(O)=C2 |
| InChI | InChI=1S/C13H13FN2O4S/c1-16-12-8-5-7(14)3-4-10(8)21(2,19,20)6-9(12)11(15-16)13(17)18/h3-6,19-20H,1-2H3,(H,17,18) |
| InChIKey | RTOZUTNLAXDJDP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|