About N-(2-ethylpenta-1,4-dienyl)ethanimine
N-(2-ethylpenta-1,4-dienyl)ethanimine (PubChem CID 123272277) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is N-(2-ethylpenta-1,4-dienyl)ethanimine.
Molecular Properties
| Compound Name | N-(2-ethylpenta-1,4-dienyl)ethanimine |
| PubChem CID | 123272277 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-(2-ethylpenta-1,4-dienyl)ethanimine |
| SMILES | C=CCC(=C/N=C/C)CC |
| InChI | InChI=1S/C9H15N/c1-4-7-9(5-2)8-10-6-3/h4,6,8H,1,5,7H2,2-3H3/b9-8?,10-6+ |
| InChIKey | MYQZHMHETTUSLR-XYXFOIJRSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethylpenta-1,4-dienyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylpenta-1,4-dienyl)ethanimine?
The IUPAC name of N-(2-ethylpenta-1,4-dienyl)ethanimine (CID 123272277) is N-(2-ethylpenta-1,4-dienyl)ethanimine.
What is the SMILES notation for N-(2-ethylpenta-1,4-dienyl)ethanimine?
The canonical SMILES for N-(2-ethylpenta-1,4-dienyl)ethanimine is C=CCC(=C/N=C/C)CC.
What is the InChIKey of N-(2-ethylpenta-1,4-dienyl)ethanimine?
The InChIKey is MYQZHMHETTUSLR-XYXFOIJRSA-N. The full InChI is InChI=1S/C9H15N/c1-4-7-9(5-2)8-10-6-3/h4,6,8H,1,5,7H2,2-3H3/b9-8?,10-6+.
What are the key properties of N-(2-ethylpenta-1,4-dienyl)ethanimine?
N-(2-ethylpenta-1,4-dienyl)ethanimine has a molecular weight of 137.23 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylpenta-1,4-dienyl)ethanimine is sourced from PubChem (CID 123272277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).