methyl 2-(2-silyloxan-2-yl)prop-2-enoate

C9H16O3Si — CID 123272322

IUPACmethyl 2-(2-silyloxan-2-yl)prop-2-enoate
SMILESC=C(C(=O)OC)C1([SiH3])CCCCO1
InChIInChI=1S/C9H16O3Si/c1-7(8(10)11-2)9(13)5-3-4-6-12-9/h1,3-6H2,2,13H3
InChIKeyKBQNTAAZNZGIEF-UHFFFAOYSA-N
MW200.31 g/mol
LogP-0.02
Rot. Bonds2

About methyl 2-(2-silyloxan-2-yl)prop-2-enoate

methyl 2-(2-silyloxan-2-yl)prop-2-enoate (PubChem CID 123272322) has the molecular formula C9H16O3Si and a molecular weight of 200.31 g/mol. Its IUPAC name is methyl 2-(2-silyloxan-2-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-(2-silyloxan-2-yl)prop-2-enoate
PubChem CID123272322
Molecular FormulaC9H16O3Si
Molecular Weight200.31 g/mol
Exact Mass200.09
IUPAC Namemethyl 2-(2-silyloxan-2-yl)prop-2-enoate
SMILESC=C(C(=O)OC)C1([SiH3])CCCCO1
InChIInChI=1S/C9H16O3Si/c1-7(8(10)11-2)9(13)5-3-4-6-12-9/h1,3-6H2,2,13H3
InChIKeyKBQNTAAZNZGIEF-UHFFFAOYSA-N
XLogP-0.02
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.31
LogP ≤ 5-0.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-(2-silyloxan-2-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-silyloxan-2-yl)prop-2-enoate?
The IUPAC name of methyl 2-(2-silyloxan-2-yl)prop-2-enoate (CID 123272322) is methyl 2-(2-silyloxan-2-yl)prop-2-enoate.
What is the SMILES notation for methyl 2-(2-silyloxan-2-yl)prop-2-enoate?
The canonical SMILES for methyl 2-(2-silyloxan-2-yl)prop-2-enoate is C=C(C(=O)OC)C1([SiH3])CCCCO1.
What is the InChIKey of methyl 2-(2-silyloxan-2-yl)prop-2-enoate?
The InChIKey is KBQNTAAZNZGIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3Si/c1-7(8(10)11-2)9(13)5-3-4-6-12-9/h1,3-6H2,2,13H3.
What are the key properties of methyl 2-(2-silyloxan-2-yl)prop-2-enoate?
methyl 2-(2-silyloxan-2-yl)prop-2-enoate has a molecular weight of 200.31 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-silyloxan-2-yl)prop-2-enoate is sourced from PubChem (CID 123272322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).