C12H16F3N2+ — CID 123272404
methylidene-propa-1,2-dienyl-[[(6,6,6-trifluoro-4-methylhexa-1,3-dienyl)amino]methyl]azanium (PubChem CID 123272404) has the molecular formula C12H16F3N2+ and a molecular weight of 245.27 g/mol. Its IUPAC name is methylidene-propa-1,2-dienyl-[[(6,6,6-trifluoro-4-methylhexa-1,3-dienyl)amino]methyl]azanium.
| Compound Name | methylidene-propa-1,2-dienyl-[[(6,6,6-trifluoro-4-methylhexa-1,3-dienyl)amino]methyl]azanium |
|---|---|
| PubChem CID | 123272404 |
| Molecular Formula | C12H16F3N2+ |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | methylidene-propa-1,2-dienyl-[[(6,6,6-trifluoro-4-methylhexa-1,3-dienyl)amino]methyl]azanium |
| SMILES | C=C=C[N+](=C)CNC=CC=C(C)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3N2/c1-4-8-17(3)10-16-7-5-6-11(2)9-12(13,14)15/h5-8,16H,1,3,9-10H2,2H3/q+1 |
| InChIKey | HQBNZQGDGQTEPG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|