C35H51ClO6 — CID 123272725
[3a-(1-acetyloxy-2-chloro-2-oxoethyl)-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl] acetate (PubChem CID 123272725) has the molecular formula C35H51ClO6 and a molecular weight of 603.24 g/mol. Its IUPAC name is [3a-(1-acetyloxy-2-chloro-2-oxoethyl)-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [3a-(1-acetyloxy-2-chloro-2-oxoethyl)-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 123272725 |
| Molecular Formula | C35H51ClO6 |
| Molecular Weight | 603.24 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | [3a-(1-acetyloxy-2-chloro-2-oxoethyl)-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl] acetate |
| SMILES | CC(=O)OC(C(=O)Cl)C12CCC3(C)C(CCC4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C1=C(C(C)C)C(=O)C2 |
| InChI | InChI=1S/C35H51ClO6/c1-19(2)27-23(39)18-35(29(30(36)40)42-21(4)38)17-16-33(8)22(28(27)35)10-11-25-32(7)14-13-26(41-20(3)37)31(5,6)24(32)12-15-34(25,33)9/h19,22,24-26,29H,10-18H2,1-9H3 |
| InChIKey | DORYFGJIPVLIPQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.24 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|