About 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one
2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one (PubChem CID 123272750) has the molecular formula C21H43NO2
and a molecular weight of 341.58 g/mol. Its IUPAC name is 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one.
Molecular Properties
| Compound Name | 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one |
| PubChem CID | 123272750 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one |
| SMILES | CC(C)(C)CC(C)(CNC(C)(C)C(=O)CCCCCO)C(C)(C)C |
| InChI | InChI=1S/C21H43NO2/c1-18(2,3)15-21(9,19(4,5)6)16-22-20(7,8)17(24)13-11-10-12-14-23/h22-23H,10-16H2,1-9H3 |
| InChIKey | XQJGDMUAKWHYTG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one?
The IUPAC name of 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one (CID 123272750) is 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one.
What is the SMILES notation for 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one?
The canonical SMILES for 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one is CC(C)(C)CC(C)(CNC(C)(C)C(=O)CCCCCO)C(C)(C)C.
What is the InChIKey of 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one?
The InChIKey is XQJGDMUAKWHYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO2/c1-18(2,3)15-21(9,19(4,5)6)16-22-20(7,8)17(24)13-11-10-12-14-23/h22-23H,10-16H2,1-9H3.
What are the key properties of 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one?
2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one has a molecular weight of 341.58 g/mol, XLogP of 4.97, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-tert-butyl-2,4,4-trimethylpentyl)amino]-8-hydroxy-2-methyloctan-3-one is sourced from PubChem (CID 123272750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).