About 4-hepta-2,4-dien-3-ylmorpholine
4-hepta-2,4-dien-3-ylmorpholine (PubChem CID 123272752) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-hepta-2,4-dien-3-ylmorpholine.
Molecular Properties
| Compound Name | 4-hepta-2,4-dien-3-ylmorpholine |
| PubChem CID | 123272752 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-hepta-2,4-dien-3-ylmorpholine |
| SMILES | CC=C(C=CCC)N1CCOCC1 |
| InChI | InChI=1S/C11H19NO/c1-3-5-6-11(4-2)12-7-9-13-10-8-12/h4-6H,3,7-10H2,1-2H3 |
| InChIKey | FJTOXPNBZPPFLQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-hepta-2,4-dien-3-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hepta-2,4-dien-3-ylmorpholine?
The IUPAC name of 4-hepta-2,4-dien-3-ylmorpholine (CID 123272752) is 4-hepta-2,4-dien-3-ylmorpholine.
What is the SMILES notation for 4-hepta-2,4-dien-3-ylmorpholine?
The canonical SMILES for 4-hepta-2,4-dien-3-ylmorpholine is CC=C(C=CCC)N1CCOCC1.
What is the InChIKey of 4-hepta-2,4-dien-3-ylmorpholine?
The InChIKey is FJTOXPNBZPPFLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-5-6-11(4-2)12-7-9-13-10-8-12/h4-6H,3,7-10H2,1-2H3.
What are the key properties of 4-hepta-2,4-dien-3-ylmorpholine?
4-hepta-2,4-dien-3-ylmorpholine has a molecular weight of 181.28 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hepta-2,4-dien-3-ylmorpholine is sourced from PubChem (CID 123272752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).