About 3-methyl-6-methylidene-1,2-dihydrotriazine
3-methyl-6-methylidene-1,2-dihydrotriazine (PubChem CID 123273085) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 3-methyl-6-methylidene-1,2-dihydrotriazine.
Molecular Properties
| Compound Name | 3-methyl-6-methylidene-1,2-dihydrotriazine |
| PubChem CID | 123273085 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 3-methyl-6-methylidene-1,2-dihydrotriazine |
| SMILES | C=C1C=CN(C)NN1 |
| InChI | InChI=1S/C5H9N3/c1-5-3-4-8(2)7-6-5/h3-4,6-7H,1H2,2H3 |
| InChIKey | VHMVUDXTTWPCQD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-6-methylidene-1,2-dihydrotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-methylidene-1,2-dihydrotriazine?
The IUPAC name of 3-methyl-6-methylidene-1,2-dihydrotriazine (CID 123273085) is 3-methyl-6-methylidene-1,2-dihydrotriazine.
What is the SMILES notation for 3-methyl-6-methylidene-1,2-dihydrotriazine?
The canonical SMILES for 3-methyl-6-methylidene-1,2-dihydrotriazine is C=C1C=CN(C)NN1.
What is the InChIKey of 3-methyl-6-methylidene-1,2-dihydrotriazine?
The InChIKey is VHMVUDXTTWPCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-5-3-4-8(2)7-6-5/h3-4,6-7H,1H2,2H3.
What are the key properties of 3-methyl-6-methylidene-1,2-dihydrotriazine?
3-methyl-6-methylidene-1,2-dihydrotriazine has a molecular weight of 111.15 g/mol, XLogP of -0.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-methylidene-1,2-dihydrotriazine is sourced from PubChem (CID 123273085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).