About 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine
4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine (PubChem CID 123273342) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine.
Molecular Properties
| Compound Name | 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine |
| PubChem CID | 123273342 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine |
| SMILES | CCC(C)/N=C/C=C(C)CNC |
| InChI | InChI=1S/C10H20N2/c1-5-10(3)12-7-6-9(2)8-11-4/h6-7,10-11H,5,8H2,1-4H3/b9-6?,12-7+ |
| InChIKey | LDAWFFRAGHQHIV-NWDZKHQFSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine?
The IUPAC name of 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine (CID 123273342) is 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine.
What is the SMILES notation for 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine?
The canonical SMILES for 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine is CCC(C)/N=C/C=C(C)CNC.
What is the InChIKey of 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine?
The InChIKey is LDAWFFRAGHQHIV-NWDZKHQFSA-N. The full InChI is InChI=1S/C10H20N2/c1-5-10(3)12-7-6-9(2)8-11-4/h6-7,10-11H,5,8H2,1-4H3/b9-6?,12-7+.
What are the key properties of 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine?
4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine has a molecular weight of 168.28 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-ylimino-N,2-dimethylbut-2-en-1-amine is sourced from PubChem (CID 123273342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).