C14H10F15NO — CID 123273742
2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(1-fluoroprop-2-enyl)-N-prop-2-enyloctanamide (PubChem CID 123273742) has the molecular formula C14H10F15NO and a molecular weight of 493.21 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(1-fluoroprop-2-enyl)-N-prop-2-enyloctanamide.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(1-fluoroprop-2-enyl)-N-prop-2-enyloctanamide |
|---|---|
| PubChem CID | 123273742 |
| Molecular Formula | C14H10F15NO |
| Molecular Weight | 493.21 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(1-fluoroprop-2-enyl)-N-prop-2-enyloctanamide |
| SMILES | C=CCNC(=O)C(F)(C(F)C=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F15NO/c1-3-5-30-7(31)8(16,6(15)4-2)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h3-4,6H,1-2,5H2,(H,30,31) |
| InChIKey | BOPQVUWIVUDYQZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.21 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|