C19H34N2O4 — CID 123273994
tert-butyl 4-(4-ethoxycarbonylpiperidin-1-yl)azepane-1-carboxylate (PubChem CID 123273994) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl 4-(4-ethoxycarbonylpiperidin-1-yl)azepane-1-carboxylate.
| Compound Name | tert-butyl 4-(4-ethoxycarbonylpiperidin-1-yl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 123273994 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | tert-butyl 4-(4-ethoxycarbonylpiperidin-1-yl)azepane-1-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2CCCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H34N2O4/c1-5-24-17(22)15-8-12-20(13-9-15)16-7-6-11-21(14-10-16)18(23)25-19(2,3)4/h15-16H,5-14H2,1-4H3 |
| InChIKey | RILHVUCQEARXFY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |