C9H11F6NO5S2 — CID 123274679
1,1,2,2,3,3-hexafluoro-3-(4-formylpiperidin-1-yl)sulfonylpropane-1-sulfinic acid (PubChem CID 123274679) has the molecular formula C9H11F6NO5S2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(4-formylpiperidin-1-yl)sulfonylpropane-1-sulfinic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(4-formylpiperidin-1-yl)sulfonylpropane-1-sulfinic acid |
|---|---|
| PubChem CID | 123274679 |
| Molecular Formula | C9H11F6NO5S2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(4-formylpiperidin-1-yl)sulfonylpropane-1-sulfinic acid |
| SMILES | O=CC1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)O)CC1 |
| InChI | InChI=1S/C9H11F6NO5S2/c10-7(11,8(12,13)22(18)19)9(14,15)23(20,21)16-3-1-6(5-17)2-4-16/h5-6H,1-4H2,(H,18,19) |
| InChIKey | POFUCJXOHYEBSD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|