C23H30F3N3O4S2 — CID 123275202
[4-[[4-thiophen-2-ylsulfonyl-1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]piperazin-2-yl]methyl]morpholin-2-yl]methanol (PubChem CID 123275202) has the molecular formula C23H30F3N3O4S2 and a molecular weight of 533.64 g/mol. Its IUPAC name is [4-[[4-thiophen-2-ylsulfonyl-1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]piperazin-2-yl]methyl]morpholin-2-yl]methanol.
| Compound Name | [4-[[4-thiophen-2-ylsulfonyl-1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]piperazin-2-yl]methyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 123275202 |
| Molecular Formula | C23H30F3N3O4S2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | [4-[[4-thiophen-2-ylsulfonyl-1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]piperazin-2-yl]methyl]morpholin-2-yl]methanol |
| SMILES | CC(c1ccc(N2CCN(S(=O)(=O)c3cccs3)CC2CN2CCOC(CO)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H30F3N3O4S2/c1-17(23(24,25)26)18-4-6-19(7-5-18)29-9-8-28(35(31,32)22-3-2-12-34-22)14-20(29)13-27-10-11-33-21(15-27)16-30/h2-7,12,17,20-21,30H,8-11,13-16H2,1H3 |
| InChIKey | FTGQMXNPEOMSOO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|