C31H31Cl2N7O3 — CID 123275929
1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one (PubChem CID 123275929) has the molecular formula C31H31Cl2N7O3 and a molecular weight of 620.54 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 123275929 |
| Molecular Formula | C31H31Cl2N7O3 |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | 1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
| SMILES | [C-]#[N+]C(=CC(C)(C)C)C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccc(Cl)c(Cl)c4)c(OC)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C31H31Cl2N7O3/c1-31(2,3)15-23(35-4)30(41)39-12-6-7-19(16-39)40-29-26(28(34)36-17-37-29)27(38-40)18-8-11-24(25(13-18)42-5)43-20-9-10-21(32)22(33)14-20/h8-11,13-15,17,19H,6-7,12,16H2,1-3,5H3,(H2,34,36,37) |
| InChIKey | GVLQGZCJZBWRAG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|