About 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine
1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine (PubChem CID 123276142) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine |
| PubChem CID | 123276142 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine |
| SMILES | CCCC(C1CCC(C)=CC1C)N(C)C |
| InChI | InChI=1S/C14H27N/c1-6-7-14(15(4)5)13-9-8-11(2)10-12(13)3/h10,12-14H,6-9H2,1-5H3 |
| InChIKey | XZLQQAKNYCQENI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine?
The IUPAC name of 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine (CID 123276142) is 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine.
What is the SMILES notation for 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine?
The canonical SMILES for 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine is CCCC(C1CCC(C)=CC1C)N(C)C.
What is the InChIKey of 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine?
The InChIKey is XZLQQAKNYCQENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N/c1-6-7-14(15(4)5)13-9-8-11(2)10-12(13)3/h10,12-14H,6-9H2,1-5H3.
What are the key properties of 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine?
1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine has a molecular weight of 209.38 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylcyclohex-3-en-1-yl)-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 123276142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).