C31H42ClN3O9 — CID 123276221
(11-chloro-21-hydroxy-12,20-dimethoxy-2,5,16-trimethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-(methylamino)propanoate (PubChem CID 123276221) has the molecular formula C31H42ClN3O9 and a molecular weight of 636.14 g/mol. Its IUPAC name is (11-chloro-21-hydroxy-12,20-dimethoxy-2,5,16-trimethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-(methylamino)propanoate.
| Compound Name | (11-chloro-21-hydroxy-12,20-dimethoxy-2,5,16-trimethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-(methylamino)propanoate |
|---|---|
| PubChem CID | 123276221 |
| Molecular Formula | C31H42ClN3O9 |
| Molecular Weight | 636.14 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | (11-chloro-21-hydroxy-12,20-dimethoxy-2,5,16-trimethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl) 2-(methylamino)propanoate |
| SMILES | CNC(C)C(=O)OC1CC(=O)Nc2cc(cc(OC)c2Cl)CC(C)=CC=CC(OC)C2(O)CC(OC(=O)N2)C(C)C2OC12C |
| InChI | InChI=1S/C31H42ClN3O9/c1-16-9-8-10-23(41-7)31(39)15-22(42-29(38)35-31)17(2)27-30(4,44-27)24(43-28(37)18(3)33-5)14-25(36)34-20-12-19(11-16)13-21(40-6)26(20)32/h8-10,12-13,17-18,22-24,27,33,39H,11,14-15H2,1-7H3,(H,34,36)(H,35,38) |
| InChIKey | YQXJZFHFUDZJSI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 156.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.14 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|