C23H37N3O2 — CID 123276467
1-[4-[2-(3-hydroxy-3-methylcyclohexyl)ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 123276467) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-[4-[2-(3-hydroxy-3-methylcyclohexyl)ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(1H-1,2,4-triazol-5-yl)ethanone.
| Compound Name | 1-[4-[2-(3-hydroxy-3-methylcyclohexyl)ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(1H-1,2,4-triazol-5-yl)ethanone |
|---|---|
| PubChem CID | 123276467 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 1-[4-[2-(3-hydroxy-3-methylcyclohexyl)ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-(1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | CC1(O)CCCC(CCC2CCCC3(C)C(C(=O)Cc4ncn[nH]4)CCC23)C1 |
| InChI | InChI=1S/C23H37N3O2/c1-22(28)11-3-5-16(14-22)7-8-17-6-4-12-23(2)18(17)9-10-19(23)20(27)13-21-24-15-25-26-21/h15-19,28H,3-14H2,1-2H3,(H,24,25,26) |
| InChIKey | DDNNEYODNRGTFJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |