About N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide
N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide (PubChem CID 123276873) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide |
| PubChem CID | 123276873 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide |
| SMILES | CC(C)CC(C)(C)C(=O)NC(C)(C)CCO |
| InChI | InChI=1S/C13H27NO2/c1-10(2)9-12(3,4)11(16)14-13(5,6)7-8-15/h10,15H,7-9H2,1-6H3,(H,14,16) |
| InChIKey | IKHCFKJWHGVMCG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide?
The IUPAC name of N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide (CID 123276873) is N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide.
What is the SMILES notation for N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide?
The canonical SMILES for N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide is CC(C)CC(C)(C)C(=O)NC(C)(C)CCO.
What is the InChIKey of N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide?
The InChIKey is IKHCFKJWHGVMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-10(2)9-12(3,4)11(16)14-13(5,6)7-8-15/h10,15H,7-9H2,1-6H3,(H,14,16).
What are the key properties of N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide?
N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide has a molecular weight of 229.36 g/mol, XLogP of 2.34, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-2-methylbutan-2-yl)-2,2,4-trimethylpentanamide is sourced from PubChem (CID 123276873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).