C31H39N5O7 — CID 123277042
(4aS,5aR,12aS)-9-[(4-tert-butylimidazol-1-yl)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123277042) has the molecular formula C31H39N5O7 and a molecular weight of 593.68 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-[(4-tert-butylimidazol-1-yl)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-[(4-tert-butylimidazol-1-yl)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123277042 |
| Molecular Formula | C31H39N5O7 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | (4aS,5aR,12aS)-9-[(4-tert-butylimidazol-1-yl)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(Cn2cnc(C(C)(C)C)c2)c(O)c2c1C[C@H]1C[C@H]3C(N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H39N5O7/c1-30(2,3)19-12-36(13-33-19)11-15-10-18(34(4)5)16-8-14-9-17-23(35(6)7)26(39)22(29(32)42)28(41)31(17,43)27(40)20(14)25(38)21(16)24(15)37/h10,12-14,17,20,22-23,37,43H,8-9,11H2,1-7H3,(H2,32,42)/t14-,17-,20?,22?,23?,31-/m0/s1 |
| InChIKey | SLRHPVZATCVQTH-LZKQYEOMSA-N |
| XLogP | 0.48 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|