C24H30N4O4 — CID 123277304
5-[4-(4-methoxyphenoxy)piperidine-1-carbonyl]-N-piperidin-4-ylpyridine-2-carboxamide (PubChem CID 123277304) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenoxy)piperidine-1-carbonyl]-N-piperidin-4-ylpyridine-2-carboxamide.
| Compound Name | 5-[4-(4-methoxyphenoxy)piperidine-1-carbonyl]-N-piperidin-4-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123277304 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-[4-(4-methoxyphenoxy)piperidine-1-carbonyl]-N-piperidin-4-ylpyridine-2-carboxamide |
| SMILES | COc1ccc(OC2CCN(C(=O)c3ccc(C(=O)NC4CCNCC4)nc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O4/c1-31-19-3-5-20(6-4-19)32-21-10-14-28(15-11-21)24(30)17-2-7-22(26-16-17)23(29)27-18-8-12-25-13-9-18/h2-7,16,18,21,25H,8-15H2,1H3,(H,27,29) |
| InChIKey | HUUVBUYHBVQMPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |