C27H30FN4O3+ — CID 123277400
7-[7-cyclopropyl-5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 123277400) has the molecular formula C27H30FN4O3+ and a molecular weight of 477.56 g/mol. Its IUPAC name is 7-[7-cyclopropyl-5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 7-[7-cyclopropyl-5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123277400 |
| Molecular Formula | C27H30FN4O3+ |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 7-[7-cyclopropyl-5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-(2,2-dimethylpropyl)-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | CC(C)(C)CC1OC2CN(C(=O)C3=C[N+]4=C(c5ccc(F)cc5)C=C(C5CC5)C4=N3)CCN2C1=O |
| InChI | InChI=1S/C27H30FN4O3/c1-27(2,3)13-22-26(34)31-11-10-30(15-23(31)35-22)25(33)20-14-32-21(17-6-8-18(28)9-7-17)12-19(16-4-5-16)24(32)29-20/h6-9,12,14,16,22-23H,4-5,10-11,13,15H2,1-3H3/q+1 |
| InChIKey | XYYOVPQTDXKCDW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|