About N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine
N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine (PubChem CID 123277485) has the molecular formula C17H30Cl2N2O2Si
and a molecular weight of 393.43 g/mol. Its IUPAC name is N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine.
Molecular Properties
| Compound Name | N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine |
| PubChem CID | 123277485 |
| Molecular Formula | C17H30Cl2N2O2Si |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine |
| SMILES | CC[Si](CC)(CC)OC(CNC(C)COC)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C17H30Cl2N2O2Si/c1-6-24(7-2,8-3)23-16(11-21-13(4)12-22-5)17-14(18)9-20-10-15(17)19/h9-10,13,16,21H,6-8,11-12H2,1-5H3 |
| InChIKey | NWSHFMHACZBJIX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine?
The IUPAC name of N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine (CID 123277485) is N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine.
What is the SMILES notation for N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine?
The canonical SMILES for N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine is CC[Si](CC)(CC)OC(CNC(C)COC)c1c(Cl)cncc1Cl.
What is the InChIKey of N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine?
The InChIKey is NWSHFMHACZBJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30Cl2N2O2Si/c1-6-24(7-2,8-3)23-16(11-21-13(4)12-22-5)17-14(18)9-20-10-15(17)19/h9-10,13,16,21H,6-8,11-12H2,1-5H3.
What are the key properties of N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine?
N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine has a molecular weight of 393.43 g/mol, XLogP of 5.08, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dichloro-4-pyridinyl)-2-triethylsilyloxyethyl]-1-methoxypropan-2-amine is sourced from PubChem (CID 123277485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).