C35H33ClFN6S2+ — CID 123277735
5-[5-(2-chlorophenyl)-2-fluoro-4-pyridinyl]-3-[2-methyl-3-[4-[2-(propylamino)-1,3-thiazol-5-yl]-3-pyridinyl]phenyl]-N-propyl-1,3-thiazol-3-ium-2-amine (PubChem CID 123277735) has the molecular formula C35H33ClFN6S2+ and a molecular weight of 656.28 g/mol. Its IUPAC name is 5-[5-(2-chlorophenyl)-2-fluoro-4-pyridinyl]-3-[2-methyl-3-[4-[2-(propylamino)-1,3-thiazol-5-yl]-3-pyridinyl]phenyl]-N-propyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | 5-[5-(2-chlorophenyl)-2-fluoro-4-pyridinyl]-3-[2-methyl-3-[4-[2-(propylamino)-1,3-thiazol-5-yl]-3-pyridinyl]phenyl]-N-propyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 123277735 |
| Molecular Formula | C35H33ClFN6S2+ |
| Molecular Weight | 656.28 g/mol |
| Exact Mass | 655.19 |
| IUPAC Name | 5-[5-(2-chlorophenyl)-2-fluoro-4-pyridinyl]-3-[2-methyl-3-[4-[2-(propylamino)-1,3-thiazol-5-yl]-3-pyridinyl]phenyl]-N-propyl-1,3-thiazol-3-ium-2-amine |
| SMILES | CCCNc1ncc(-c2ccncc2-c2cccc(-[n+]3cc(-c4cc(F)ncc4-c4ccccc4Cl)sc3NCCC)c2C)s1 |
| InChI | InChI=1S/C35H32ClFN6S2/c1-4-14-39-34-42-20-31(44-34)25-13-16-38-18-27(25)23-10-8-12-30(22(23)3)43-21-32(45-35(43)40-15-5-2)26-17-33(37)41-19-28(26)24-9-6-7-11-29(24)36/h6-13,16-21H,4-5,14-15H2,1-3H3,(H,38,39,42)/p+1 |
| InChIKey | DJJKNWFQTINNHC-UHFFFAOYSA-O |
| XLogP | 9.68 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.28 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|