C27H45N5O4S — CID 123277865
[1-[4-(2,5-diaminopentanoylamino)phenyl]-2-(1-methylazocan-4-yl)-2-oxoethyl] N-methyl-N-(2-methyl-1-sulfanylpropyl)carbamate (PubChem CID 123277865) has the molecular formula C27H45N5O4S and a molecular weight of 535.76 g/mol. Its IUPAC name is [1-[4-(2,5-diaminopentanoylamino)phenyl]-2-(1-methylazocan-4-yl)-2-oxoethyl] N-methyl-N-(2-methyl-1-sulfanylpropyl)carbamate.
| Compound Name | [1-[4-(2,5-diaminopentanoylamino)phenyl]-2-(1-methylazocan-4-yl)-2-oxoethyl] N-methyl-N-(2-methyl-1-sulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 123277865 |
| Molecular Formula | C27H45N5O4S |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | [1-[4-(2,5-diaminopentanoylamino)phenyl]-2-(1-methylazocan-4-yl)-2-oxoethyl] N-methyl-N-(2-methyl-1-sulfanylpropyl)carbamate |
| SMILES | CC(C)C(S)N(C)C(=O)OC(C(=O)C1CCCCN(C)CC1)c1ccc(NC(=O)C(N)CCCN)cc1 |
| InChI | InChI=1S/C27H45N5O4S/c1-18(2)26(37)32(4)27(35)36-24(23(33)19-8-5-6-16-31(3)17-14-19)20-10-12-21(13-11-20)30-25(34)22(29)9-7-15-28/h10-13,18-19,22,24,26,37H,5-9,14-17,28-29H2,1-4H3,(H,30,34) |
| InChIKey | GGOLKEOXVJSNGN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|