C17H16FN7S — CID 123277926
1-[(2-fluorophenyl)methyl]-N-methylidene-N'-propanimidoyl-5-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboximidamide (PubChem CID 123277926) has the molecular formula C17H16FN7S and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-methylidene-N'-propanimidoyl-5-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboximidamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-methylidene-N'-propanimidoyl-5-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 123277926 |
| Molecular Formula | C17H16FN7S |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-methylidene-N'-propanimidoyl-5-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboximidamide |
| SMILES | [H]/N=C(CC)/N=C(\N=C)c1nc(-c2nccs2)n(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C17H16FN7S/c1-3-13(19)22-14(20-2)15-23-16(17-21-8-9-26-17)25(24-15)10-11-6-4-5-7-12(11)18/h4-9,19H,2-3,10H2,1H3/b19-13+,22-14- |
| InChIKey | DPZKGOXORPBPBZ-MEUPMUBXSA-N |
| XLogP | 3.42 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|