About (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde
(2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde (PubChem CID 123278427) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde.
Molecular Properties
| Compound Name | (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde |
| PubChem CID | 123278427 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde |
| SMILES | C[C@H]1CO[C@H](C=O)CO1 |
| InChI | InChI=1S/C6H10O3/c1-5-3-9-6(2-7)4-8-5/h2,5-6H,3-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | YTDHXNLLEURJTN-NTSWFWBYSA-N |
| XLogP | -0.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde?
The IUPAC name of (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde (CID 123278427) is (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde.
What is the SMILES notation for (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde?
The canonical SMILES for (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde is C[C@H]1CO[C@H](C=O)CO1.
What is the InChIKey of (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde?
The InChIKey is YTDHXNLLEURJTN-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H10O3/c1-5-3-9-6(2-7)4-8-5/h2,5-6H,3-4H2,1H3/t5-,6+/m0/s1.
What are the key properties of (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde?
(2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde has a molecular weight of 130.14 g/mol, XLogP of -0.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-5-methyl-1,4-dioxane-2-carbaldehyde is sourced from PubChem (CID 123278427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).