About oct-2-en-4-yl N-propan-2-ylcarbamate
oct-2-en-4-yl N-propan-2-ylcarbamate (PubChem CID 123278450) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is oct-2-en-4-yl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | oct-2-en-4-yl N-propan-2-ylcarbamate |
| PubChem CID | 123278450 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | oct-2-en-4-yl N-propan-2-ylcarbamate |
| SMILES | CC=CC(CCCC)OC(=O)NC(C)C |
| InChI | InChI=1S/C12H23NO2/c1-5-7-9-11(8-6-2)15-12(14)13-10(3)4/h6,8,10-11H,5,7,9H2,1-4H3,(H,13,14) |
| InChIKey | TZUQDLZYDQXJIS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-2-en-4-yl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-2-en-4-yl N-propan-2-ylcarbamate?
The IUPAC name of oct-2-en-4-yl N-propan-2-ylcarbamate (CID 123278450) is oct-2-en-4-yl N-propan-2-ylcarbamate.
What is the SMILES notation for oct-2-en-4-yl N-propan-2-ylcarbamate?
The canonical SMILES for oct-2-en-4-yl N-propan-2-ylcarbamate is CC=CC(CCCC)OC(=O)NC(C)C.
What is the InChIKey of oct-2-en-4-yl N-propan-2-ylcarbamate?
The InChIKey is TZUQDLZYDQXJIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-5-7-9-11(8-6-2)15-12(14)13-10(3)4/h6,8,10-11H,5,7,9H2,1-4H3,(H,13,14).
What are the key properties of oct-2-en-4-yl N-propan-2-ylcarbamate?
oct-2-en-4-yl N-propan-2-ylcarbamate has a molecular weight of 213.32 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-2-en-4-yl N-propan-2-ylcarbamate is sourced from PubChem (CID 123278450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).