C28H36F2N4O2S — CID 123278712
N-(2,2-difluoroethyl)-3-[4-(2-ethoxy-5-methyl-4-propylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-methylpropanamide (PubChem CID 123278712) has the molecular formula C28H36F2N4O2S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-[4-(2-ethoxy-5-methyl-4-propylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-methylpropanamide.
| Compound Name | N-(2,2-difluoroethyl)-3-[4-(2-ethoxy-5-methyl-4-propylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 123278712 |
| Molecular Formula | C28H36F2N4O2S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-[4-(2-ethoxy-5-methyl-4-propylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-N-methylpropanamide |
| SMILES | CCCc1cc(OCC)c(Nc2ncnc3sc4c(c23)CCC(CCC(=O)N(C)CC(F)F)C4)cc1C |
| InChI | InChI=1S/C28H36F2N4O2S/c1-5-7-19-14-22(36-6-2)21(12-17(19)3)33-27-26-20-10-8-18(9-11-25(35)34(4)15-24(29)30)13-23(20)37-28(26)32-16-31-27/h12,14,16,18,24H,5-11,13,15H2,1-4H3,(H,31,32,33) |
| InChIKey | IJHXMFICTXBXJV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |