C26H37FN4O2 — CID 123278872
5-[2-[2-[2-fluoro-4-(methyliminomethyl)cyclohexyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]ethyl]-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 123278872) has the molecular formula C26H37FN4O2 and a molecular weight of 456.61 g/mol. Its IUPAC name is 5-[2-[2-[2-fluoro-4-(methyliminomethyl)cyclohexyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]ethyl]-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | 5-[2-[2-[2-fluoro-4-(methyliminomethyl)cyclohexyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]ethyl]-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 123278872 |
| Molecular Formula | C26H37FN4O2 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 5-[2-[2-[2-fluoro-4-(methyliminomethyl)cyclohexyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]ethyl]-4-methyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | C/N=C/C1CCC(c2ncc3c(n2)CCN(CCC2CCC4C(=O)OCC4C2C)C3)C(F)C1 |
| InChI | InChI=1S/C26H37FN4O2/c1-16-18(4-6-20-22(16)15-33-26(20)32)7-9-31-10-8-24-19(14-31)13-29-25(30-24)21-5-3-17(12-28-2)11-23(21)27/h12-13,16-18,20-23H,3-11,14-15H2,1-2H3/b28-12+ |
| InChIKey | UEEUYYOWRJQCTL-KVSWJAHQSA-N |
| XLogP | 3.98 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|