C8H16O2S — CID 123278904
5,5-dimethyl-7-methylsulfanyl-1,4-dioxepane (PubChem CID 123278904) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 5,5-dimethyl-7-methylsulfanyl-1,4-dioxepane.
| Compound Name | 5,5-dimethyl-7-methylsulfanyl-1,4-dioxepane |
|---|---|
| PubChem CID | 123278904 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5,5-dimethyl-7-methylsulfanyl-1,4-dioxepane |
| SMILES | CSC1CC(C)(C)OCCO1 |
| InChI | InChI=1S/C8H16O2S/c1-8(2)6-7(11-3)9-4-5-10-8/h7H,4-6H2,1-3H3 |
| InChIKey | SJNLPVAKFVANBA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |