C19H22N2O8 — CID 123278922
(4E,5E)-4-[[(2E,5E)-2,6-dicarboxyhepta-2,5-dien-4-ylidene]hydrazinylidene]-2,3,6-trimethylhepta-2,5-dienedioic acid (PubChem CID 123278922) has the molecular formula C19H22N2O8 and a molecular weight of 406.39 g/mol. Its IUPAC name is (4E,5E)-4-[[(2E,5E)-2,6-dicarboxyhepta-2,5-dien-4-ylidene]hydrazinylidene]-2,3,6-trimethylhepta-2,5-dienedioic acid.
| Compound Name | (4E,5E)-4-[[(2E,5E)-2,6-dicarboxyhepta-2,5-dien-4-ylidene]hydrazinylidene]-2,3,6-trimethylhepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 123278922 |
| Molecular Formula | C19H22N2O8 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (4E,5E)-4-[[(2E,5E)-2,6-dicarboxyhepta-2,5-dien-4-ylidene]hydrazinylidene]-2,3,6-trimethylhepta-2,5-dienedioic acid |
| SMILES | CC(C(=O)O)=C(C)C(/C=C(\C)C(=O)O)=N/N=C(/C=C(\C)C(=O)O)/C=C(\C)C(=O)O |
| InChI | InChI=1S/C19H22N2O8/c1-9(16(22)23)6-14(7-10(2)17(24)25)20-21-15(8-11(3)18(26)27)12(4)13(5)19(28)29/h6-8H,1-5H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29)/b9-6+,10-7+,11-8+,13-12?,21-15+ |
| InChIKey | SPUWQZJVMBHQBB-CHEGJSPKSA-N |
| XLogP | 2.30 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|