C22H35NO5 — CID 123279632
ethyl (1S,4R,6R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadecane-4-carboxylate (PubChem CID 123279632) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is ethyl (1S,4R,6R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadecane-4-carboxylate.
| Compound Name | ethyl (1S,4R,6R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadecane-4-carboxylate |
|---|---|
| PubChem CID | 123279632 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | ethyl (1S,4R,6R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadecane-4-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(=O)[C@@H]3C[C@H](O)CN3C(=O)[C@@H](C)CCCCCCC[C@@H]1C2 |
| InChI | InChI=1S/C22H35NO5/c1-3-28-21(27)22-12-16(22)10-8-6-4-5-7-9-15(2)20(26)23-14-17(24)11-18(23)19(25)13-22/h15-18,24H,3-14H2,1-2H3/t15-,16+,17-,18-,22+/m0/s1 |
| InChIKey | XFUITISRKGVVOE-ROGOSAHYSA-N |
| XLogP | 2.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |