C20H26N2 — CID 123279919
3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenylimino]butanenitrile (PubChem CID 123279919) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenylimino]butanenitrile.
| Compound Name | 3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenylimino]butanenitrile |
|---|---|
| PubChem CID | 123279919 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenylimino]butanenitrile |
| SMILES | C=C(/N=C(\C)CC#N)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C20H26N2/c1-14(9-12-21)22-15(2)16-7-8-17-18(13-16)20(5,6)11-10-19(17,3)4/h7-8,13H,2,9-11H2,1,3-6H3/b22-14+ |
| InChIKey | UVULRGCGFOEIPG-HYARGMPZSA-N |
| XLogP | 5.38 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|