About 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine
4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine (PubChem CID 123280119) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine.
Molecular Properties
| Compound Name | 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine |
| PubChem CID | 123280119 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine |
| SMILES | CSC1=C(C)CCNC1 |
| InChI | InChI=1S/C7H13NS/c1-6-3-4-8-5-7(6)9-2/h8H,3-5H2,1-2H3 |
| InChIKey | QUBPUMWRHHSIRX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine?
The IUPAC name of 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine (CID 123280119) is 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine is CSC1=C(C)CCNC1.
What is the InChIKey of 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine?
The InChIKey is QUBPUMWRHHSIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-6-3-4-8-5-7(6)9-2/h8H,3-5H2,1-2H3.
What are the key properties of 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine?
4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine has a molecular weight of 143.25 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-methylsulfanyl-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 123280119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).